C32H35ClN4O4 — CID 163939637
2-(4-chloro-6-phenyl-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxopyrrolidin-3-yl)pentan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 163939637) has the molecular formula C32H35ClN4O4 and a molecular weight of 575.11 g/mol. Its IUPAC name is 2-(4-chloro-6-phenyl-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxopyrrolidin-3-yl)pentan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | 2-(4-chloro-6-phenyl-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxopyrrolidin-3-yl)pentan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 163939637 |
| Molecular Formula | C32H35ClN4O4 |
| Molecular Weight | 575.11 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 2-(4-chloro-6-phenyl-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxopyrrolidin-3-yl)pentan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CCC(=O)C(CC1CCNC1=O)NC(=O)C1C2CCCC2CN1C(=O)c1cc2c(Cl)cc(-c3ccccc3)cc2[nH]1 |
| InChI | InChI=1S/C32H35ClN4O4/c1-2-28(38)26(14-19-11-12-34-30(19)39)36-31(40)29-22-10-6-9-20(22)17-37(29)32(41)27-16-23-24(33)13-21(15-25(23)35-27)18-7-4-3-5-8-18/h3-5,7-8,13,15-16,19-20,22,26,29,35H,2,6,9-12,14,17H2,1H3,(H,34,39)(H,36,40) |
| InChIKey | FOXRCSGVZCRKDB-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.11 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |