C33H36ClN3O4 — CID 163938315
2-(4-chloro-7-phenyl-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxocyclopentyl)pentan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 163938315) has the molecular formula C33H36ClN3O4 and a molecular weight of 574.12 g/mol. Its IUPAC name is 2-(4-chloro-7-phenyl-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxocyclopentyl)pentan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | 2-(4-chloro-7-phenyl-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxocyclopentyl)pentan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 163938315 |
| Molecular Formula | C33H36ClN3O4 |
| Molecular Weight | 574.12 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | 2-(4-chloro-7-phenyl-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxocyclopentyl)pentan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CCC(=O)C(CC1CCCC1=O)NC(=O)C1C2CCCC2CN1C(=O)c1cc2c(Cl)ccc(-c3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C33H36ClN3O4/c1-2-28(38)26(16-20-10-7-13-29(20)39)36-32(40)31-23-12-6-11-21(23)18-37(31)33(41)27-17-24-25(34)15-14-22(30(24)35-27)19-8-4-3-5-9-19/h3-5,8-9,14-15,17,20-21,23,26,31,35H,2,6-7,10-13,16,18H2,1H3,(H,36,40) |
| InChIKey | STWLHDCGIULTDP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.12 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |