C26H31ClN4O5 — CID 175447378
(3S)-N-[4-chloro-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 175447378) has the molecular formula C26H31ClN4O5 and a molecular weight of 515.01 g/mol. Its IUPAC name is (3S)-N-[4-chloro-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S)-N-[4-chloro-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175447378 |
| Molecular Formula | C26H31ClN4O5 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | (3S)-N-[4-chloro-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N3CC4CCCC4[C@H]3C(=O)NC(C[C@@H]3CCNC3=O)C(=O)CCl)cc12 |
| InChI | InChI=1S/C26H31ClN4O5/c1-36-22-7-3-6-18-17(22)11-20(29-18)26(35)31-13-15-4-2-5-16(15)23(31)25(34)30-19(21(32)12-27)10-14-8-9-28-24(14)33/h3,6-7,11,14-16,19,23,29H,2,4-5,8-10,12-13H2,1H3,(H,28,33)(H,30,34)/t14-,15?,16?,19?,23-/m0/s1 |
| InChIKey | APIGQOKYEQLSCD-ILQGPYCUSA-N |
| XLogP | 2.24 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|