C35H42N4O6 — CID 162695492
2-(4-methoxy-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxopiperidin-3-yl)-4-phenylmethoxybutan-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxamide (PubChem CID 162695492) has the molecular formula C35H42N4O6 and a molecular weight of 614.74 g/mol. Its IUPAC name is 2-(4-methoxy-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxopiperidin-3-yl)-4-phenylmethoxybutan-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxamide.
| Compound Name | 2-(4-methoxy-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxopiperidin-3-yl)-4-phenylmethoxybutan-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 162695492 |
| Molecular Formula | C35H42N4O6 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | 2-(4-methoxy-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxopiperidin-3-yl)-4-phenylmethoxybutan-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N3CC4CCCCC4C3C(=O)NC(CC3CCCNC3=O)C(=O)COCc3ccccc3)cc12 |
| InChI | InChI=1S/C35H42N4O6/c1-44-31-15-7-14-27-26(31)18-29(37-27)35(43)39-19-24-11-5-6-13-25(24)32(39)34(42)38-28(17-23-12-8-16-36-33(23)41)30(40)21-45-20-22-9-3-2-4-10-22/h2-4,7,9-10,14-15,18,23-25,28,32,37H,5-6,8,11-13,16-17,19-21H2,1H3,(H,36,41)(H,38,42) |
| InChIKey | SWMWXURGVXIZLJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 129.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |