C36H43N3O6 — CID 163889941
2-(4-methoxy-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxocyclohexyl)-4-phenylmethoxybutan-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxamide (PubChem CID 163889941) has the molecular formula C36H43N3O6 and a molecular weight of 613.76 g/mol. Its IUPAC name is 2-(4-methoxy-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxocyclohexyl)-4-phenylmethoxybutan-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxamide.
| Compound Name | 2-(4-methoxy-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxocyclohexyl)-4-phenylmethoxybutan-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxamide |
|---|---|
| PubChem CID | 163889941 |
| Molecular Formula | C36H43N3O6 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.32 |
| IUPAC Name | 2-(4-methoxy-1H-indole-2-carbonyl)-N-[3-oxo-1-(2-oxocyclohexyl)-4-phenylmethoxybutan-2-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-1-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N3CC4CCCCC4C3C(=O)NC(CC3CCCCC3=O)C(=O)COCc3ccccc3)cc12 |
| InChI | InChI=1S/C36H43N3O6/c1-44-33-17-9-15-28-27(33)19-30(37-28)36(43)39-20-25-13-5-7-14-26(25)34(39)35(42)38-29(18-24-12-6-8-16-31(24)40)32(41)22-45-21-23-10-3-2-4-11-23/h2-4,9-11,15,17,19,24-26,29,34,37H,5-8,12-14,16,18,20-22H2,1H3,(H,38,42) |
| InChIKey | IKZAWOHIKCMMQQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |