C28H36N3O8P — CID 163923389
[3-[[2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carbonyl]amino]-2-oxo-4-(2-oxocyclopentyl)butoxy]-methylphosphinic acid (PubChem CID 163923389) has the molecular formula C28H36N3O8P and a molecular weight of 573.58 g/mol. Its IUPAC name is [3-[[2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carbonyl]amino]-2-oxo-4-(2-oxocyclopentyl)butoxy]-methylphosphinic acid.
| Compound Name | [3-[[2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carbonyl]amino]-2-oxo-4-(2-oxocyclopentyl)butoxy]-methylphosphinic acid |
|---|---|
| PubChem CID | 163923389 |
| Molecular Formula | C28H36N3O8P |
| Molecular Weight | 573.58 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | [3-[[2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carbonyl]amino]-2-oxo-4-(2-oxocyclopentyl)butoxy]-methylphosphinic acid |
| SMILES | COc1cccc2[nH]c(C(=O)N3CC4CCCC4C3C(=O)NC(CC3CCCC3=O)C(=O)COP(C)(=O)O)cc12 |
| InChI | InChI=1S/C28H36N3O8P/c1-38-25-11-5-9-20-19(25)13-22(29-20)28(35)31-14-17-7-3-8-18(17)26(31)27(34)30-21(12-16-6-4-10-23(16)32)24(33)15-39-40(2,36)37/h5,9,11,13,16-18,21,26,29H,3-4,6-8,10,12,14-15H2,1-2H3,(H,30,34)(H,36,37) |
| InChIKey | VVFMAJGXELDEIS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.58 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|