C30H36F2N4O6 — CID 163936102
N-[4-(2,2-difluoropropylamino)-3,4-dioxo-1-(2-oxocyclopentyl)butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 163936102) has the molecular formula C30H36F2N4O6 and a molecular weight of 586.64 g/mol. Its IUPAC name is N-[4-(2,2-difluoropropylamino)-3,4-dioxo-1-(2-oxocyclopentyl)butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | N-[4-(2,2-difluoropropylamino)-3,4-dioxo-1-(2-oxocyclopentyl)butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 163936102 |
| Molecular Formula | C30H36F2N4O6 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | N-[4-(2,2-difluoropropylamino)-3,4-dioxo-1-(2-oxocyclopentyl)butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N3CC4CCCC4C3C(=O)NC(CC3CCCC3=O)C(=O)C(=O)NCC(C)(F)F)cc12 |
| InChI | InChI=1S/C30H36F2N4O6/c1-30(31,32)15-33-28(40)26(38)21(12-16-6-4-10-23(16)37)35-27(39)25-18-8-3-7-17(18)14-36(25)29(41)22-13-19-20(34-22)9-5-11-24(19)42-2/h5,9,11,13,16-18,21,25,34H,3-4,6-8,10,12,14-15H2,1-2H3,(H,33,40)(H,35,39) |
| InChIKey | YKAITQDKMVTFJZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|