C34H39N5O6 — CID 166936902
N-[4-[benzyl(methyl)amino]-3,4-dioxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 166936902) has the molecular formula C34H39N5O6 and a molecular weight of 613.72 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)amino]-3,4-dioxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | N-[4-[benzyl(methyl)amino]-3,4-dioxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 166936902 |
| Molecular Formula | C34H39N5O6 |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 613.29 |
| IUPAC Name | N-[4-[benzyl(methyl)amino]-3,4-dioxo-1-(2-oxopyrrolidin-3-yl)butan-2-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N3CC4CCCC4C3C(=O)NC(CC3CCNC3=O)C(=O)C(=O)N(C)Cc3ccccc3)cc12 |
| InChI | InChI=1S/C34H39N5O6/c1-38(18-20-8-4-3-5-9-20)34(44)30(40)26(16-21-14-15-35-31(21)41)37-32(42)29-23-11-6-10-22(23)19-39(29)33(43)27-17-24-25(36-27)12-7-13-28(24)45-2/h3-5,7-9,12-13,17,21-23,26,29,36H,6,10-11,14-16,18-19H2,1-2H3,(H,35,41)(H,37,42) |
| InChIKey | AJJKWIHRWRQBFZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 140.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|