C25H30F3N5O6 — CID 175537467
(3S)-2-[2-[(3-methyl-2-pyridinyl)amino]-2-oxoacetyl]-N-[3-oxo-1-(2-oxopyrrolidin-3-yl)-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 175537467) has the molecular formula C25H30F3N5O6 and a molecular weight of 553.54 g/mol. Its IUPAC name is (3S)-2-[2-[(3-methyl-2-pyridinyl)amino]-2-oxoacetyl]-N-[3-oxo-1-(2-oxopyrrolidin-3-yl)-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S)-2-[2-[(3-methyl-2-pyridinyl)amino]-2-oxoacetyl]-N-[3-oxo-1-(2-oxopyrrolidin-3-yl)-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175537467 |
| Molecular Formula | C25H30F3N5O6 |
| Molecular Weight | 553.54 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | (3S)-2-[2-[(3-methyl-2-pyridinyl)amino]-2-oxoacetyl]-N-[3-oxo-1-(2-oxopyrrolidin-3-yl)-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | Cc1cccnc1NC(=O)C(=O)N1CC2CCCC2[C@H]1C(=O)NC(CC1CCNC1=O)C(=O)COC(F)(F)F |
| InChI | InChI=1S/C25H30F3N5O6/c1-13-4-3-8-29-20(13)32-23(37)24(38)33-11-15-5-2-6-16(15)19(33)22(36)31-17(10-14-7-9-30-21(14)35)18(34)12-39-25(26,27)28/h3-4,8,14-17,19H,2,5-7,9-12H2,1H3,(H,30,35)(H,31,36)(H,29,32,37)/t14?,15?,16?,17?,19-/m0/s1 |
| InChIKey | ZLJFUFGBVDFPBW-JXDCGSQQSA-N |
| XLogP | 1.07 |
| TPSA | 146.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.54 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|