C29H37F3N4O6 — CID 175537510
(3S)-2-[2-(2-tert-butylanilino)-2-oxoacetyl]-N-[3-oxo-1-(2-oxopyrrolidin-3-yl)-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 175537510) has the molecular formula C29H37F3N4O6 and a molecular weight of 594.63 g/mol. Its IUPAC name is (3S)-2-[2-(2-tert-butylanilino)-2-oxoacetyl]-N-[3-oxo-1-(2-oxopyrrolidin-3-yl)-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S)-2-[2-(2-tert-butylanilino)-2-oxoacetyl]-N-[3-oxo-1-(2-oxopyrrolidin-3-yl)-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 175537510 |
| Molecular Formula | C29H37F3N4O6 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | (3S)-2-[2-(2-tert-butylanilino)-2-oxoacetyl]-N-[3-oxo-1-(2-oxopyrrolidin-3-yl)-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)C(=O)N1CC2CCCC2[C@H]1C(=O)NC(CC1CCNC1=O)C(=O)COC(F)(F)F |
| InChI | InChI=1S/C29H37F3N4O6/c1-28(2,3)19-9-4-5-10-20(19)34-26(40)27(41)36-14-17-7-6-8-18(17)23(36)25(39)35-21(13-16-11-12-33-24(16)38)22(37)15-42-29(30,31)32/h4-5,9-10,16-18,21,23H,6-8,11-15H2,1-3H3,(H,33,38)(H,34,40)(H,35,39)/t16?,17?,18?,21?,23-/m0/s1 |
| InChIKey | QJTIPDNGNDUSSF-FZQQRWMJSA-N |
| XLogP | 2.67 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|