C23H33F3N4O6 — CID 166169834
2-[2-(tert-butylamino)-2-oxoacetyl]-N-[3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 166169834) has the molecular formula C23H33F3N4O6 and a molecular weight of 518.53 g/mol. Its IUPAC name is 2-[2-(tert-butylamino)-2-oxoacetyl]-N-[3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | 2-[2-(tert-butylamino)-2-oxoacetyl]-N-[3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 166169834 |
| Molecular Formula | C23H33F3N4O6 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 2-[2-(tert-butylamino)-2-oxoacetyl]-N-[3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(trifluoromethoxy)butan-2-yl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | CC(C)(C)NC(=O)C(=O)N1CC2CCCC2C1C(=O)NC(C[C@@H]1CCNC1=O)C(=O)COC(F)(F)F |
| InChI | InChI=1S/C23H33F3N4O6/c1-22(2,3)29-20(34)21(35)30-10-13-5-4-6-14(13)17(30)19(33)28-15(9-12-7-8-27-18(12)32)16(31)11-36-23(24,25)26/h12-15,17H,4-11H2,1-3H3,(H,27,32)(H,28,33)(H,29,34)/t12-,13?,14?,15?,17?/m0/s1 |
| InChIKey | VDSXCXQXESCXAK-ORVZXPRGSA-N |
| XLogP | 0.64 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|