C15H27N5O3 — CID 170017491
(2S)-2-[[2-hydrazinyl-3-(1-methylcyclopropyl)propanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanamide (PubChem CID 170017491) has the molecular formula C15H27N5O3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2S)-2-[[2-hydrazinyl-3-(1-methylcyclopropyl)propanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanamide.
| Compound Name | (2S)-2-[[2-hydrazinyl-3-(1-methylcyclopropyl)propanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 170017491 |
| Molecular Formula | C15H27N5O3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.21 |
| IUPAC Name | (2S)-2-[[2-hydrazinyl-3-(1-methylcyclopropyl)propanoyl]amino]-3-[(3S)-2-oxopiperidin-3-yl]propanamide |
| SMILES | CC1(CC(NN)C(=O)N[C@@H](C[C@@H]2CCCNC2=O)C(N)=O)CC1 |
| InChI | InChI=1S/C15H27N5O3/c1-15(4-5-15)8-11(20-17)14(23)19-10(12(16)21)7-9-3-2-6-18-13(9)22/h9-11,20H,2-8,17H2,1H3,(H2,16,21)(H,18,22)(H,19,23)/t9-,10-,11?/m0/s1 |
| InChIKey | UCCHNWTWLIGYJC-QRHSGQBVSA-N |
| XLogP | -1.11 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|