C13H23N3O4 — CID 167238360
tert-butyl N-[1-amino-1-oxo-3-(2-oxopiperidin-3-yl)propan-2-yl]carbamate (PubChem CID 167238360) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is tert-butyl N-[1-amino-1-oxo-3-(2-oxopiperidin-3-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-amino-1-oxo-3-(2-oxopiperidin-3-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 167238360 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | tert-butyl N-[1-amino-1-oxo-3-(2-oxopiperidin-3-yl)propan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CC1CCCNC1=O)C(N)=O |
| InChI | InChI=1S/C13H23N3O4/c1-13(2,3)20-12(19)16-9(10(14)17)7-8-5-4-6-15-11(8)18/h8-9H,4-7H2,1-3H3,(H2,14,17)(H,15,18)(H,16,19) |
| InChIKey | WXEYHBRHQFSIFF-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |