C19H31F2N3O5 — CID 168941896
tert-butyl N-[4-(3,3-difluoroazetidin-1-yl)-3,4-dioxo-1-(2-oxopiperidin-3-yl)butan-2-yl]carbamate;ethane (PubChem CID 168941896) has the molecular formula C19H31F2N3O5 and a molecular weight of 419.47 g/mol. Its IUPAC name is tert-butyl N-[4-(3,3-difluoroazetidin-1-yl)-3,4-dioxo-1-(2-oxopiperidin-3-yl)butan-2-yl]carbamate;ethane.
| Compound Name | tert-butyl N-[4-(3,3-difluoroazetidin-1-yl)-3,4-dioxo-1-(2-oxopiperidin-3-yl)butan-2-yl]carbamate;ethane |
|---|---|
| PubChem CID | 168941896 |
| Molecular Formula | C19H31F2N3O5 |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | tert-butyl N-[4-(3,3-difluoroazetidin-1-yl)-3,4-dioxo-1-(2-oxopiperidin-3-yl)butan-2-yl]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NC(CC1CCCNC1=O)C(=O)C(=O)N1CC(F)(F)C1 |
| InChI | InChI=1S/C17H25F2N3O5.C2H6/c1-16(2,3)27-15(26)21-11(7-10-5-4-6-20-13(10)24)12(23)14(25)22-8-17(18,19)9-22;1-2/h10-11H,4-9H2,1-3H3,(H,20,24)(H,21,26);1-2H3 |
| InChIKey | KIBVIZNZYXSWRI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|