C14H22N2O4 — CID 162695922
tert-butyl N-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]pent-4-en-2-yl]carbamate (PubChem CID 162695922) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]pent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]pent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 162695922 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | tert-butyl N-[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]pent-4-en-2-yl]carbamate |
| SMILES | C=CC(=O)[C@H](C[C@@H]1CCNC1=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22N2O4/c1-5-11(17)10(8-9-6-7-15-12(9)18)16-13(19)20-14(2,3)4/h5,9-10H,1,6-8H2,2-4H3,(H,15,18)(H,16,19)/t9-,10-/m0/s1 |
| InChIKey | AUJQGRWVVMOMQP-UWVGGRQHSA-N |
| XLogP | 1.16 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|