C13H24N2O6 — CID 166936770
tert-butyl N-[(2S)-3,4,4-trihydroxy-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]carbamate (PubChem CID 166936770) has the molecular formula C13H24N2O6 and a molecular weight of 304.34 g/mol. Its IUPAC name is tert-butyl N-[(2S)-3,4,4-trihydroxy-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-3,4,4-trihydroxy-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 166936770 |
| Molecular Formula | C13H24N2O6 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | tert-butyl N-[(2S)-3,4,4-trihydroxy-1-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C[C@@H]1CCNC1=O)C(O)C(O)O |
| InChI | InChI=1S/C13H24N2O6/c1-13(2,3)21-12(20)15-8(9(16)11(18)19)6-7-4-5-14-10(7)17/h7-9,11,16,18-19H,4-6H2,1-3H3,(H,14,17)(H,15,20)/t7-,8-,9?/m0/s1 |
| InChIKey | LNZXITKCSJJWCP-JVIMKECRSA-N |
| XLogP | -0.92 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|