C5H3F6O3S- — CID 140609706
2,2,3,3,4,4-hexafluorocyclopentane-1-sulfonate (PubChem CID 140609706) has the molecular formula C5H3F6O3S- and a molecular weight of 257.13 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluorocyclopentane-1-sulfonate.
| Compound Name | 2,2,3,3,4,4-hexafluorocyclopentane-1-sulfonate |
|---|---|
| PubChem CID | 140609706 |
| Molecular Formula | C5H3F6O3S- |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | 2,2,3,3,4,4-hexafluorocyclopentane-1-sulfonate |
| SMILES | O=S(=O)([O-])C1CC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C5H4F6O3S/c6-3(7)1-2(15(12,13)14)4(8,9)5(3,10)11/h2H,1H2,(H,12,13,14)/p-1 |
| InChIKey | PUEADXBPBDBBOC-UHFFFAOYSA-M |
| XLogP | 1.21 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|