H8N2O3S2 — CID 6096946
diazanium;dioxido-oxo-sulfanylidene-λ6-sulfane (PubChem CID 6096946) has the molecular formula H8N2O3S2 and a molecular weight of 148.21 g/mol. Its IUPAC name is diazanium;dioxido-oxo-sulfanylidene-λ6-sulfane.
| Compound Name | diazanium;dioxido-oxo-sulfanylidene-λ6-sulfane |
|---|---|
| PubChem CID | 6096946 |
| Molecular Formula | H8N2O3S2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.00 |
| IUPAC Name | diazanium;dioxido-oxo-sulfanylidene-λ6-sulfane |
| SMILES | O=S([O-])([O-])=S.[NH4+].[NH4+] |
| InChI | InChI=1S/2H3N.H2O3S2/c;;1-5(2,3)4/h2*1H3;(H2,1,2,3,4) |
| InChIKey | XYXNTHIYBIDHGM-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 136.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |