About bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+)
bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+) (PubChem CID 172773772) has the molecular formula O6S4Ti
and a molecular weight of 272.13 g/mol. Its IUPAC name is bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+).
Molecular Properties
| Compound Name | bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+) |
| PubChem CID | 172773772 |
| Molecular Formula | O6S4Ti |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.81 |
| IUPAC Name | bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+) |
| SMILES | O=S([O-])([O-])=S.O=S([O-])([O-])=S.[Ti+4] |
| InChI | InChI=1S/2H2O3S2.Ti/c2*1-5(2,3)4;/h2*(H2,1,2,3,4);/q;;+4/p-4 |
| InChIKey | NHRVIENLFZAEPU-UHFFFAOYSA-J |
| XLogP | -2.02 |
| TPSA | 126.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+)?
The IUPAC name of bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+) (CID 172773772) is bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+).
What is the SMILES notation for bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+)?
The canonical SMILES for bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+) is O=S([O-])([O-])=S.O=S([O-])([O-])=S.[Ti+4].
What is the InChIKey of bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+)?
The InChIKey is NHRVIENLFZAEPU-UHFFFAOYSA-J. The full InChI is InChI=1S/2H2O3S2.Ti/c2*1-5(2,3)4;/h2*(H2,1,2,3,4);/q;;+4/p-4.
What are the key properties of bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+)?
bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+) has a molecular weight of 272.13 g/mol, XLogP of -2.02, 0 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(dioxido-oxo-sulfanylidene-λ6-sulfane);titanium(4+) is sourced from PubChem (CID 172773772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).