About azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum
azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum (PubChem CID 159475965) has the molecular formula H4NO3PtS2-
and a molecular weight of 325.25 g/mol. Its IUPAC name is azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum.
Molecular Properties
| Compound Name | azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum |
| PubChem CID | 159475965 |
| Molecular Formula | H4NO3PtS2- |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.93 |
| IUPAC Name | azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum |
| SMILES | O=S([O-])([O-])=S.[NH4+].[Pt] |
| InChI | InChI=1S/H3N.H2O3S2.Pt/c;1-5(2,3)4;/h1H3;(H2,1,2,3,4);/p-1 |
| InChIKey | ACKFGBZMIAGESK-UHFFFAOYSA-M |
| XLogP | -0.63 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum?
The IUPAC name of azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum (CID 159475965) is azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum.
What is the SMILES notation for azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum?
The canonical SMILES for azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum is O=S([O-])([O-])=S.[NH4+].[Pt].
What is the InChIKey of azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum?
The InChIKey is ACKFGBZMIAGESK-UHFFFAOYSA-M. The full InChI is InChI=1S/H3N.H2O3S2.Pt/c;1-5(2,3)4;/h1H3;(H2,1,2,3,4);/p-1.
What are the key properties of azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum?
azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum has a molecular weight of 325.25 g/mol, XLogP of -0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;dioxido-oxo-sulfanylidene-λ6-sulfane;platinum is sourced from PubChem (CID 159475965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).