C8H10F6O — CID 19911060
1,1,2,2,3,3-hexafluoro-4-propan-2-yloxycyclopentane (PubChem CID 19911060) has the molecular formula C8H10F6O and a molecular weight of 236.16 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-4-propan-2-yloxycyclopentane.
| Compound Name | 1,1,2,2,3,3-hexafluoro-4-propan-2-yloxycyclopentane |
|---|---|
| PubChem CID | 19911060 |
| Molecular Formula | C8H10F6O |
| Molecular Weight | 236.16 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-4-propan-2-yloxycyclopentane |
| SMILES | CC(C)OC1CC(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C8H10F6O/c1-4(2)15-5-3-6(9,10)8(13,14)7(5,11)12/h4-5H,3H2,1-2H3 |
| InChIKey | DLQDUBKMSPMVAQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.16 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|