C14H6F22O3 — CID 155670528
1,1,2,2-tetrafluoro-3,3,4-tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentane (PubChem CID 155670528) has the molecular formula C14H6F22O3 and a molecular weight of 640.15 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-3,3,4-tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentane.
| Compound Name | 1,1,2,2-tetrafluoro-3,3,4-tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentane |
|---|---|
| PubChem CID | 155670528 |
| Molecular Formula | C14H6F22O3 |
| Molecular Weight | 640.15 g/mol |
| Exact Mass | 640.00 |
| IUPAC Name | 1,1,2,2-tetrafluoro-3,3,4-tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentane |
| SMILES | FC(F)(F)C(OC1CC(F)(F)C(F)(F)C1(OC(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H6F22O3/c15-6(16)1-2(37-3(8(17,18)19)9(20,21)22)7(14(6,35)36,38-4(10(23,24)25)11(26,27)28)39-5(12(29,30)31)13(32,33)34/h2-5H,1H2 |
| InChIKey | SQXQYCFOYZATFY-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.15 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|