C14H5F23O3 — CID 155670593
cis-(4S,5R)-1,1,2,2,4-pentafluoro-3,3,5-tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentane (PubChem CID 155670593) has the molecular formula C14H5F23O3 and a molecular weight of 658.14 g/mol. Its IUPAC name is cis-(4S,5R)-1,1,2,2,4-pentafluoro-3,3,5-tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentane.
| Compound Name | cis-(4S,5R)-1,1,2,2,4-pentafluoro-3,3,5-tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentane |
|---|---|
| PubChem CID | 155670593 |
| Molecular Formula | C14H5F23O3 |
| Molecular Weight | 658.14 g/mol |
| Exact Mass | 657.99 |
| IUPAC Name | cis-(4S,5R)-1,1,2,2,4-pentafluoro-3,3,5-tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)cyclopentane |
| SMILES | F[C@H]1[C@@H](OC(C(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C1(OC(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H5F23O3/c15-1-2(38-3(8(18,19)20)9(21,22)23)6(16,17)14(36,37)7(1,39-4(10(24,25)26)11(27,28)29)40-5(12(30,31)32)13(33,34)35/h1-5H/t1-,2+/m0/s1 |
| InChIKey | WNSRFBXRWRPUHI-NHYDCYSISA-N |
| XLogP | 7.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.14 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|