C14H11F17O3 — CID 155670498
cis-(4S,5R)-1,1,2,2,4-pentafluoro-3,3,5-tris(2,2,3,3-tetrafluoropropoxy)cyclopentane (PubChem CID 155670498) has the molecular formula C14H11F17O3 and a molecular weight of 550.21 g/mol. Its IUPAC name is cis-(4S,5R)-1,1,2,2,4-pentafluoro-3,3,5-tris(2,2,3,3-tetrafluoropropoxy)cyclopentane.
| Compound Name | cis-(4S,5R)-1,1,2,2,4-pentafluoro-3,3,5-tris(2,2,3,3-tetrafluoropropoxy)cyclopentane |
|---|---|
| PubChem CID | 155670498 |
| Molecular Formula | C14H11F17O3 |
| Molecular Weight | 550.21 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | cis-(4S,5R)-1,1,2,2,4-pentafluoro-3,3,5-tris(2,2,3,3-tetrafluoropropoxy)cyclopentane |
| SMILES | FC(F)C(F)(F)CO[C@@H]1[C@H](F)C(OCC(F)(F)C(F)F)(OCC(F)(F)C(F)F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H11F17O3/c15-4-5(32-1-9(22,23)6(16)17)12(28,29)14(30,31)13(4,33-2-10(24,25)7(18)19)34-3-11(26,27)8(20)21/h4-8H,1-3H2/t4-,5+/m0/s1 |
| InChIKey | KSFDSBUFPNEASI-CRCLSJGQSA-N |
| XLogP | 5.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.21 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|