C10H14F4O3 — CID 103272552
methyl 2-[1-(2,2,3,3-tetrafluoropropoxy)cyclobutyl]acetate (PubChem CID 103272552) has the molecular formula C10H14F4O3 and a molecular weight of 258.21 g/mol. Its IUPAC name is methyl 2-[1-(2,2,3,3-tetrafluoropropoxy)cyclobutyl]acetate.
| Compound Name | methyl 2-[1-(2,2,3,3-tetrafluoropropoxy)cyclobutyl]acetate |
|---|---|
| PubChem CID | 103272552 |
| Molecular Formula | C10H14F4O3 |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | methyl 2-[1-(2,2,3,3-tetrafluoropropoxy)cyclobutyl]acetate |
| SMILES | COC(=O)CC1(OCC(F)(F)C(F)F)CCC1 |
| InChI | InChI=1S/C10H14F4O3/c1-16-7(15)5-9(3-2-4-9)17-6-10(13,14)8(11)12/h8H,2-6H2,1H3 |
| InChIKey | QHWLRWICEBFKBV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|