C12H15BrF6O — CID 102723537
3-bromo-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)spiro[3.5]nonane (PubChem CID 102723537) has the molecular formula C12H15BrF6O and a molecular weight of 369.14 g/mol. Its IUPAC name is 3-bromo-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)spiro[3.5]nonane.
| Compound Name | 3-bromo-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)spiro[3.5]nonane |
|---|---|
| PubChem CID | 102723537 |
| Molecular Formula | C12H15BrF6O |
| Molecular Weight | 369.14 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 3-bromo-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)spiro[3.5]nonane |
| SMILES | FC(F)(F)C(OC1CC(Br)C12CCCCC2)C(F)(F)F |
| InChI | InChI=1S/C12H15BrF6O/c13-7-6-8(10(7)4-2-1-3-5-10)20-9(11(14,15)16)12(17,18)19/h7-9H,1-6H2 |
| InChIKey | PJQWLGIAXHVERH-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.14 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|