C12H18BrF3O — CID 66345296
3-bromo-1-(2,2,2-trifluoroethoxy)spiro[3.6]decane (PubChem CID 66345296) has the molecular formula C12H18BrF3O and a molecular weight of 315.17 g/mol. Its IUPAC name is 3-bromo-1-(2,2,2-trifluoroethoxy)spiro[3.6]decane.
| Compound Name | 3-bromo-1-(2,2,2-trifluoroethoxy)spiro[3.6]decane |
|---|---|
| PubChem CID | 66345296 |
| Molecular Formula | C12H18BrF3O |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-bromo-1-(2,2,2-trifluoroethoxy)spiro[3.6]decane |
| SMILES | FC(F)(F)COC1CC(Br)C12CCCCCC2 |
| InChI | InChI=1S/C12H18BrF3O/c13-9-7-10(17-8-12(14,15)16)11(9)5-3-1-2-4-6-11/h9-10H,1-8H2 |
| InChIKey | KQTPNAVIAUVHOW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|