C13H20BrF3O — CID 82795387
3-bromo-1-(4,4,4-trifluorobutoxy)spiro[3.5]nonane (PubChem CID 82795387) has the molecular formula C13H20BrF3O and a molecular weight of 329.20 g/mol. Its IUPAC name is 3-bromo-1-(4,4,4-trifluorobutoxy)spiro[3.5]nonane.
| Compound Name | 3-bromo-1-(4,4,4-trifluorobutoxy)spiro[3.5]nonane |
|---|---|
| PubChem CID | 82795387 |
| Molecular Formula | C13H20BrF3O |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 3-bromo-1-(4,4,4-trifluorobutoxy)spiro[3.5]nonane |
| SMILES | FC(F)(F)CCCOC1CC(Br)C12CCCCC2 |
| InChI | InChI=1S/C13H20BrF3O/c14-10-9-11(12(10)5-2-1-3-6-12)18-8-4-7-13(15,16)17/h10-11H,1-9H2 |
| InChIKey | CZQMYCWNSIWNBC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|