C14H24F3NO — CID 82958075
N-ethyl-3-(3,3,3-trifluoropropoxy)spiro[3.5]nonan-1-amine (PubChem CID 82958075) has the molecular formula C14H24F3NO and a molecular weight of 279.35 g/mol. Its IUPAC name is N-ethyl-3-(3,3,3-trifluoropropoxy)spiro[3.5]nonan-1-amine.
| Compound Name | N-ethyl-3-(3,3,3-trifluoropropoxy)spiro[3.5]nonan-1-amine |
|---|---|
| PubChem CID | 82958075 |
| Molecular Formula | C14H24F3NO |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | N-ethyl-3-(3,3,3-trifluoropropoxy)spiro[3.5]nonan-1-amine |
| SMILES | CCNC1CC(OCCC(F)(F)F)C12CCCCC2 |
| InChI | InChI=1S/C14H24F3NO/c1-2-18-11-10-12(19-9-8-14(15,16)17)13(11)6-4-3-5-7-13/h11-12,18H,2-10H2,1H3 |
| InChIKey | GBVJMQCHRUTJSL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |