C15H26F3NO — CID 82956691
N-ethyl-3-(3,3,3-trifluoropropoxy)spiro[3.6]decan-1-amine (PubChem CID 82956691) has the molecular formula C15H26F3NO and a molecular weight of 293.37 g/mol. Its IUPAC name is N-ethyl-3-(3,3,3-trifluoropropoxy)spiro[3.6]decan-1-amine.
| Compound Name | N-ethyl-3-(3,3,3-trifluoropropoxy)spiro[3.6]decan-1-amine |
|---|---|
| PubChem CID | 82956691 |
| Molecular Formula | C15H26F3NO |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | N-ethyl-3-(3,3,3-trifluoropropoxy)spiro[3.6]decan-1-amine |
| SMILES | CCNC1CC(OCCC(F)(F)F)C12CCCCCC2 |
| InChI | InChI=1S/C15H26F3NO/c1-2-19-12-11-13(20-10-9-15(16,17)18)14(12)7-5-3-4-6-8-14/h12-13,19H,2-11H2,1H3 |
| InChIKey | SSKOCHRBDUFBJM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |