C13H22F3NO — CID 65170650
3-ethoxy-N-(2,2,2-trifluoroethyl)spiro[3.5]nonan-1-amine (PubChem CID 65170650) has the molecular formula C13H22F3NO and a molecular weight of 265.32 g/mol. Its IUPAC name is 3-ethoxy-N-(2,2,2-trifluoroethyl)spiro[3.5]nonan-1-amine.
| Compound Name | 3-ethoxy-N-(2,2,2-trifluoroethyl)spiro[3.5]nonan-1-amine |
|---|---|
| PubChem CID | 65170650 |
| Molecular Formula | C13H22F3NO |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 3-ethoxy-N-(2,2,2-trifluoroethyl)spiro[3.5]nonan-1-amine |
| SMILES | CCOC1CC(NCC(F)(F)F)C12CCCCC2 |
| InChI | InChI=1S/C13H22F3NO/c1-2-18-11-8-10(17-9-13(14,15)16)12(11)6-4-3-5-7-12/h10-11,17H,2-9H2,1H3 |
| InChIKey | DBPHFPXPHWCMBP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |