C11H21NO — CID 95241163
(1S,3R)-3-ethoxy-N-methylspiro[3.4]octan-1-amine (PubChem CID 95241163) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (1S,3R)-3-ethoxy-N-methylspiro[3.4]octan-1-amine.
| Compound Name | (1S,3R)-3-ethoxy-N-methylspiro[3.4]octan-1-amine |
|---|---|
| PubChem CID | 95241163 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (1S,3R)-3-ethoxy-N-methylspiro[3.4]octan-1-amine |
| SMILES | CCO[C@@H]1C[C@H](NC)C12CCCC2 |
| InChI | InChI=1S/C11H21NO/c1-3-13-10-8-9(12-2)11(10)6-4-5-7-11/h9-10,12H,3-8H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | JWOJVXYJLYKMRD-VHSXEESVSA-N |
| XLogP | 1.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |