C11H14F6O2 — CID 102723534
3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)spiro[3.4]octan-1-ol (PubChem CID 102723534) has the molecular formula C11H14F6O2 and a molecular weight of 292.22 g/mol. Its IUPAC name is 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)spiro[3.4]octan-1-ol.
| Compound Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)spiro[3.4]octan-1-ol |
|---|---|
| PubChem CID | 102723534 |
| Molecular Formula | C11H14F6O2 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)spiro[3.4]octan-1-ol |
| SMILES | OC1CC(OC(C(F)(F)F)C(F)(F)F)C12CCCC2 |
| InChI | InChI=1S/C11H14F6O2/c12-10(13,14)8(11(15,16)17)19-7-5-6(18)9(7)3-1-2-4-9/h6-8,18H,1-5H2 |
| InChIKey | DMQGKKGKQPTJPP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |