About (2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine
(2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine (PubChem CID 131114072) has the molecular formula C8H15F2N
and a molecular weight of 163.21 g/mol. Its IUPAC name is (2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine.
Molecular Properties
| Compound Name | (2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine |
| PubChem CID | 131114072 |
| Molecular Formula | C8H15F2N |
| Molecular Weight | 163.21 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | (2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine |
| SMILES | CCC[C@@H]1NC[C@@H](C)C1(F)F |
| InChI | InChI=1S/C8H15F2N/c1-3-4-7-8(9,10)6(2)5-11-7/h6-7,11H,3-5H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | FRMIFLXDRLIICS-RQJHMYQMSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine?
The IUPAC name of (2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine (CID 131114072) is (2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine.
What is the SMILES notation for (2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine?
The canonical SMILES for (2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine is CCC[C@@H]1NC[C@@H](C)C1(F)F.
What is the InChIKey of (2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine?
The InChIKey is FRMIFLXDRLIICS-RQJHMYQMSA-N. The full InChI is InChI=1S/C8H15F2N/c1-3-4-7-8(9,10)6(2)5-11-7/h6-7,11H,3-5H2,1-2H3/t6-,7+/m1/s1.
What are the key properties of (2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine?
(2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine has a molecular weight of 163.21 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-3,3-difluoro-4-methyl-2-propylpyrrolidine is sourced from PubChem (CID 131114072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).