C7H15NS — CID 66243686
5-methyl-2-propyl-1,3-thiazolidine (PubChem CID 66243686) has the molecular formula C7H15NS and a molecular weight of 145.27 g/mol. Its IUPAC name is 5-methyl-2-propyl-1,3-thiazolidine.
| Compound Name | 5-methyl-2-propyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 66243686 |
| Molecular Formula | C7H15NS |
| Molecular Weight | 145.27 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 5-methyl-2-propyl-1,3-thiazolidine |
| SMILES | CCCC1NCC(C)S1 |
| InChI | InChI=1S/C7H15NS/c1-3-4-7-8-5-6(2)9-7/h6-8H,3-5H2,1-2H3 |
| InChIKey | WIRZZRUONZJSIR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |