C8H15NOS — CID 82837923
5-methyl-2-(oxolan-2-yl)-1,3-thiazolidine (PubChem CID 82837923) has the molecular formula C8H15NOS and a molecular weight of 173.28 g/mol. Its IUPAC name is 5-methyl-2-(oxolan-2-yl)-1,3-thiazolidine.
| Compound Name | 5-methyl-2-(oxolan-2-yl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 82837923 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | 5-methyl-2-(oxolan-2-yl)-1,3-thiazolidine |
| SMILES | CC1CNC(C2CCCO2)S1 |
| InChI | InChI=1S/C8H15NOS/c1-6-5-9-8(11-6)7-3-2-4-10-7/h6-9H,2-5H2,1H3 |
| InChIKey | VGSMDXJKOHQNRF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |