C13H29N — CID 168977682
2,3-dipropylpiperidine;ethane (PubChem CID 168977682) has the molecular formula C13H29N and a molecular weight of 199.38 g/mol. Its IUPAC name is 2,3-dipropylpiperidine;ethane.
| Compound Name | 2,3-dipropylpiperidine;ethane |
|---|---|
| PubChem CID | 168977682 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | 2,3-dipropylpiperidine;ethane |
| SMILES | CC.CCCC1CCCNC1CCC |
| InChI | InChI=1S/C11H23N.C2H6/c1-3-6-10-8-5-9-12-11(10)7-4-2;1-2/h10-12H,3-9H2,1-2H3;1-2H3 |
| InChIKey | WQIDNSHQQHFRCB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |