C9H19N — CID 89278402
(2S,3S)-2,3-diethylpiperidine (PubChem CID 89278402) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is (2S,3S)-2,3-diethylpiperidine.
| Compound Name | (2S,3S)-2,3-diethylpiperidine |
|---|---|
| PubChem CID | 89278402 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (2S,3S)-2,3-diethylpiperidine |
| SMILES | CC[C@H]1CCCN[C@H]1CC |
| InChI | InChI=1S/C9H19N/c1-3-8-6-5-7-10-9(8)4-2/h8-10H,3-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | YTQWQAVWWKLCDR-IUCAKERBSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |