C8H19N — CID 178039705
2,3-diethylpyrrolidine;molecular hydrogen (PubChem CID 178039705) has the molecular formula C8H19N and a molecular weight of 129.25 g/mol. Its IUPAC name is 2,3-diethylpyrrolidine;molecular hydrogen.
| Compound Name | 2,3-diethylpyrrolidine;molecular hydrogen |
|---|---|
| PubChem CID | 178039705 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | 2,3-diethylpyrrolidine;molecular hydrogen |
| SMILES | CCC1CCNC1CC.[H][H] |
| InChI | InChI=1S/C8H17N.H2/c1-3-7-5-6-9-8(7)4-2;/h7-9H,3-6H2,1-2H3;1H |
| InChIKey | HFDGMGIUTGOYSX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |