C11H22N2O — CID 176834143
1-(3,5-dimethylpiperazin-2-yl)-2,2-dimethylpropan-1-one (PubChem CID 176834143) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-(3,5-dimethylpiperazin-2-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(3,5-dimethylpiperazin-2-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 176834143 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 1-(3,5-dimethylpiperazin-2-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC1CNC(C(=O)C(C)(C)C)C(C)N1 |
| InChI | InChI=1S/C11H22N2O/c1-7-6-12-9(8(2)13-7)10(14)11(3,4)5/h7-9,12-13H,6H2,1-5H3 |
| InChIKey | HZNSWHWVRVCFKR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |