C11H20ClNO — CID 176833201
1-(4-chloro-3-methylpiperidin-2-yl)-2,2-dimethylpropan-1-one (PubChem CID 176833201) has the molecular formula C11H20ClNO and a molecular weight of 217.74 g/mol. Its IUPAC name is 1-(4-chloro-3-methylpiperidin-2-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(4-chloro-3-methylpiperidin-2-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 176833201 |
| Molecular Formula | C11H20ClNO |
| Molecular Weight | 217.74 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 1-(4-chloro-3-methylpiperidin-2-yl)-2,2-dimethylpropan-1-one |
| SMILES | CC1C(Cl)CCNC1C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H20ClNO/c1-7-8(12)5-6-13-9(7)10(14)11(2,3)4/h7-9,13H,5-6H2,1-4H3 |
| InChIKey | QZUXAROQAZMWFP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.74 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|