C11H17ClN2O — CID 176834157
1-(3-chloro-5-isocyanopiperidin-2-yl)-2,2-dimethylpropan-1-one (PubChem CID 176834157) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 1-(3-chloro-5-isocyanopiperidin-2-yl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(3-chloro-5-isocyanopiperidin-2-yl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 176834157 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-(3-chloro-5-isocyanopiperidin-2-yl)-2,2-dimethylpropan-1-one |
| SMILES | [C-]#[N+]C1CNC(C(=O)C(C)(C)C)C(Cl)C1 |
| InChI | InChI=1S/C11H17ClN2O/c1-11(2,3)10(15)9-8(12)5-7(13-4)6-14-9/h7-9,14H,5-6H2,1-3H3 |
| InChIKey | VEGCBHAJVZIKOK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|