About 1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one
1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one (PubChem CID 176833958) has the molecular formula C12H22F2N2O
and a molecular weight of 248.32 g/mol. Its IUPAC name is 1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one |
| PubChem CID | 176833958 |
| Molecular Formula | C12H22F2N2O |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC1NC(C(F)F)C(C)NC1C(=O)C(C)(C)C |
| InChI | InChI=1S/C12H22F2N2O/c1-6-8(10(17)12(3,4)5)15-7(2)9(16-6)11(13)14/h6-9,11,15-16H,1-5H3 |
| InChIKey | WZRQVBSRZWEEFC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one?
The IUPAC name of 1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one (CID 176833958) is 1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one is CC1NC(C(F)F)C(C)NC1C(=O)C(C)(C)C.
What is the InChIKey of 1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one?
The InChIKey is WZRQVBSRZWEEFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2N2O/c1-6-8(10(17)12(3,4)5)15-7(2)9(16-6)11(13)14/h6-9,11,15-16H,1-5H3.
What are the key properties of 1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one?
1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one has a molecular weight of 248.32 g/mol, XLogP of 1.57, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(difluoromethyl)-3,6-dimethylpiperazin-2-yl]-2,2-dimethylpropan-1-one is sourced from PubChem (CID 176833958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).