C6H12N2O — CID 15864839
N,N,3-trimethylaziridine-2-carboxamide (PubChem CID 15864839) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is N,N,3-trimethylaziridine-2-carboxamide.
| Compound Name | N,N,3-trimethylaziridine-2-carboxamide |
|---|---|
| PubChem CID | 15864839 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | N,N,3-trimethylaziridine-2-carboxamide |
| SMILES | CC1NC1C(=O)N(C)C |
| InChI | InChI=1S/C6H12N2O/c1-4-5(7-4)6(9)8(2)3/h4-5,7H,1-3H3 |
| InChIKey | LMYSKTVYGLMPAL-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 42.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|