C8H15NO3 — CID 130978140
(3S,4R,5S)-4-hydroxy-N,N,5-trimethyloxolane-3-carboxamide (PubChem CID 130978140) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is (3S,4R,5S)-4-hydroxy-N,N,5-trimethyloxolane-3-carboxamide.
| Compound Name | (3S,4R,5S)-4-hydroxy-N,N,5-trimethyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 130978140 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | (3S,4R,5S)-4-hydroxy-N,N,5-trimethyloxolane-3-carboxamide |
| SMILES | C[C@@H]1OC[C@H](C(=O)N(C)C)[C@H]1O |
| InChI | InChI=1S/C8H15NO3/c1-5-7(10)6(4-12-5)8(11)9(2)3/h5-7,10H,4H2,1-3H3/t5-,6-,7-/m0/s1 |
| InChIKey | YYTAIJHUFMGUFB-ACZMJKKPSA-N |
| XLogP | -0.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |