C5H9FO2 — CID 174197910
(2R,3R,4S)-4-fluoro-2-methyloxolan-3-ol (PubChem CID 174197910) has the molecular formula C5H9FO2 and a molecular weight of 120.12 g/mol. Its IUPAC name is (2R,3R,4S)-4-fluoro-2-methyloxolan-3-ol.
| Compound Name | (2R,3R,4S)-4-fluoro-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 174197910 |
| Molecular Formula | C5H9FO2 |
| Molecular Weight | 120.12 g/mol |
| Exact Mass | 120.06 |
| IUPAC Name | (2R,3R,4S)-4-fluoro-2-methyloxolan-3-ol |
| SMILES | C[C@H]1OC[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C5H9FO2/c1-3-5(7)4(6)2-8-3/h3-5,7H,2H2,1H3/t3-,4+,5-/m1/s1 |
| InChIKey | NLGNLBOAHKLBGH-MROZADKFSA-N |
| XLogP | 0.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.12 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |