C8H16O3 — CID 57076356
4-methoxy-2,5-dimethyloxan-3-ol (PubChem CID 57076356) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is 4-methoxy-2,5-dimethyloxan-3-ol.
| Compound Name | 4-methoxy-2,5-dimethyloxan-3-ol |
|---|---|
| PubChem CID | 57076356 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 4-methoxy-2,5-dimethyloxan-3-ol |
| SMILES | COC1C(C)COC(C)C1O |
| InChI | InChI=1S/C8H16O3/c1-5-4-11-6(2)7(9)8(5)10-3/h5-9H,4H2,1-3H3 |
| InChIKey | HGGKABGBGWFICU-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |