C8H16O3 — CID 59491822
(3R,4R)-3-methoxy-2,5-dimethyloxan-4-ol (PubChem CID 59491822) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (3R,4R)-3-methoxy-2,5-dimethyloxan-4-ol.
| Compound Name | (3R,4R)-3-methoxy-2,5-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 59491822 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (3R,4R)-3-methoxy-2,5-dimethyloxan-4-ol |
| SMILES | CO[C@H]1C(C)OCC(C)[C@H]1O |
| InChI | InChI=1S/C8H16O3/c1-5-4-11-6(2)8(10-3)7(5)9/h5-9H,4H2,1-3H3/t5?,6?,7-,8+/m1/s1 |
| InChIKey | AWBZENCQAHASDC-CRYROECRSA-N |
| XLogP | 0.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |