C7H12FNO4 — CID 122207300
N-[(2R,3S,4R,5R)-5-fluoro-2,4-dihydroxyoxan-3-yl]acetamide (PubChem CID 122207300) has the molecular formula C7H12FNO4 and a molecular weight of 193.17 g/mol. Its IUPAC name is N-[(2R,3S,4R,5R)-5-fluoro-2,4-dihydroxyoxan-3-yl]acetamide.
| Compound Name | N-[(2R,3S,4R,5R)-5-fluoro-2,4-dihydroxyoxan-3-yl]acetamide |
|---|---|
| PubChem CID | 122207300 |
| Molecular Formula | C7H12FNO4 |
| Molecular Weight | 193.17 g/mol |
| Exact Mass | 193.08 |
| IUPAC Name | N-[(2R,3S,4R,5R)-5-fluoro-2,4-dihydroxyoxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1[C@@H](O)[C@H](F)CO[C@H]1O |
| InChI | InChI=1S/C7H12FNO4/c1-3(10)9-5-6(11)4(8)2-13-7(5)12/h4-7,11-12H,2H2,1H3,(H,9,10)/t4-,5+,6+,7-/m1/s1 |
| InChIKey | FXZABAAEKMUYIW-JRTVQGFMSA-N |
| XLogP | -1.46 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.17 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |