C7H14N2O — CID 14282308
N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 14282308) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 14282308 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)C1CCCN1 |
| InChI | InChI=1S/C7H14N2O/c1-9(2)7(10)6-4-3-5-8-6/h6,8H,3-5H2,1-2H3 |
| InChIKey | MLLMAIJXIZOSFS-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |